| Compound Information | SONAR Target prediction | | Name: | ZEORIN | | Unique Identifier: | SPE01800055 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O2 | | Molecular Weight: | 394.336 g/mol | | X log p: | -0.0620000000000002 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | | Source: | ex various lichens, e.g., Anaptychia species | | Reference: | Bull Soc Chim 1963: 1702 | | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00530 | | Logp: | 3.73 | | Drug_category: | Sex Hormone-Binding Globulin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
CDC73 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4845±0.0228395 |
| Normalized OD Score: sc h |
1.0592±0.0103899 |
| Z-Score: |
1.4876±0.183623 |
| p-Value: |
0.140167 |
| Z-Factor: |
-3.52937 |
| Fitness Defect: |
1.9649 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.60 Celcius | | Date: | 2007-09-19 YYYY-MM-DD | | Plate CH Control (+): | 0.04035±0.00050 | | Plate DMSO Control (-): | 0.45255±0.04620 | | Plate Z-Factor: | 0.6153 |
| png ps pdf |
| 165675 |
(1S,2R,5S)-5-methyl-2-propan-2-yl-cyclohexan-1-ol |
| 168951 |
(3S,4aS,6aR,6aR,6bR,8aS,12aS,14aS,14bS)-4,4,6a,6b,9,9,12a,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,8a,10,11,12 ,13,14,14a-hexadecahydropicen-3-ol |
| 169854 |
8-hydroxyoctan-1-olate; titanium(+4) cation |
| 170196 |
dodecan-1-ol; tridecan-1-ol |
| 170582 |
(2R)-5-methyl-2-propan-2-yl-hexan-1-ol |
| 170591 |
n/a |
| internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
| active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|