| Compound Information | SONAR Target prediction |
| Name: | ZEORIN |
| Unique Identifier: | SPE01800055 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C30H52O2 |
| Molecular Weight: | 394.336 g/mol |
| X log p: | -0.0620000000000002 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 0 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 2 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C |
| Source: | ex various lichens, e.g., Anaptychia species |
| Reference: | Bull Soc Chim 1963: 1702 |
| Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL |
| Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL |
| Drug_type: | Experimental |
| Drugbank_id: | EXPT00530 |
| Logp: | 3.73 |
| Drug_category: | Sex Hormone-Binding Globulin inhibitor |
| Organisms_affected: | -1 |
| Found: 101 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [101] |
| Species: | 4932 |
| Condition: | APC9 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6964±0.00325269 |
| Normalized OD Score: sc h | 0.9945±0.0011446 |
| Z-Score: | -0.2967±0.0577088 |
| p-Value: | 0.766918 |
| Z-Factor: | -38.1942 |
| Fitness Defect: | 0.2654 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 2037 | [1] << Back 61 62 63 64 65 66 67 68 69 70 Next >> [340] |
| 111394 | 4-(1,6,6-trimethylnorpinan-2-yl)cyclohexan-1-ol |
| 112065 | 4-cyclohexylbutan-2-ol |
| 112066 | 4-(4-ethylcyclohexyl)-4-methyl-pentan-2-ol |
| 112067 | 4-methyl-4-(4-propan-2-ylcyclohexyl)pentan-2-ol |
| 112095 | n/a |
| 112096 | n/a |
| internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
| BTB 12413 | 0.9231 |
| RJC 00940 | 0.9231 |
| JFD 01247 | 0.9231 |
| NRB 02212 | 0.9231 |
| BTB 14986 | 0.9231 |
| BTB 14459 | 0.9231 |
| active | Cluster 466 | Additional Members: 1 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory