Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BNI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7060±0.00523259 |
Normalized OD Score: sc h |
0.9969±0.00848354 |
Z-Score: |
-0.1446±0.41434 |
p-Value: |
0.771864 |
Z-Factor: |
-23.4064 |
Fitness Defect: |
0.2589 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2007-09-14 YYYY-MM-DD | Plate CH Control (+): | 0.04215±0.00127 | Plate DMSO Control (-): | 0.6956±0.03546 | Plate Z-Factor: | 0.8258 |
| png ps pdf |
107356 |
4-methyl-4-(4-methylcyclohexyl)pentan-2-ol |
107491 |
(1S,3R,4R,6R)-4,7,7-trimethylnorcaran-3-ol |
107492 |
(1S,3S,4R,6R)-4,7,7-trimethylnorcaran-3-ol |
107493 |
(1R,3S,4R,6S)-4,7,7-trimethylnorcaran-3-ol |
108424 |
1-(2,2,6-trimethylcyclohexyl)pentan-3-ol |
108425 |
3-methyl-4-(2,2,6-trimethylcyclohexyl)butan-2-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|