Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
GCN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.3911±0.0289207 |
Normalized OD Score: sc h |
1.0579±0.103258 |
Z-Score: |
0.9865±1.76323 |
p-Value: |
0.41008 |
Z-Factor: |
-6.7518 |
Fitness Defect: |
0.8914 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-10-30 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00042 | Plate DMSO Control (-): | 0.38149999999999995±0.03574 | Plate Z-Factor: | 0.6392 |
| png ps pdf |
16057696 |
n/a |
16057709 |
(5S,7S)-3-ethyladamantan-1-ol |
16057773 |
(1S,4S,6R)-6,7,7-trimethylbicyclo[2.2.1]heptan-6-ol |
16059117 |
cyclopentane; dicyclopentylmethanol; iron(+2) cation |
16061344 |
(3S,5S,8S,9S,10S,13S,14S,17R)-17-[(2S,3S,5R)-3-hydroxy-5,6-dimethyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5, 6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
16061351 |
n/a |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|