Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.7874±0.0039598 |
Normalized OD Score: sc h |
1.0389±0.00211692 |
Z-Score: |
1.0537±0.0947096 |
p-Value: |
0.293124 |
Z-Factor: |
-0.796994 |
Fitness Defect: |
1.2272 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2006-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.03875±0.00135 | Plate DMSO Control (-): | 0.760575±0.01986 | Plate Z-Factor: | 0.9112 |
| png ps pdf |
11626494 |
(3S,5R,8R,9R,10S,12R,13S,14R,17R)-4,4,8,10,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,9,11,1 2,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
11725710 |
7-hexyloctadecan-1-ol |
11725711 |
12-hexyloctadecan-1-ol |
11750021 |
(3S,5S,8S,9S,10S,13R,14S,17R)-17-[(2R,4R)-4-ethyl-5-methyl-hexan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11 ,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
11775746 |
n/a |
11775887 |
(2S,4aR,5S,8aR)-5-(hydroxymethyl)-1,1,4a-trimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|