Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
TEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6171±0.00523259 |
Normalized OD Score: sc h |
1.0007±0.00706854 |
Z-Score: |
0.0129±0.187561 |
p-Value: |
0.894498 |
Z-Factor: |
-269.685 |
Fitness Defect: |
0.1115 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.40 Celcius | Date: | 2005-12-23 YYYY-MM-DD | Plate CH Control (+): | 0.038825±0.00155 | Plate DMSO Control (-): | 0.601325±0.02069 | Plate Z-Factor: | 0.8832 |
| png ps pdf |
7567270 |
(3R,4R)-3-methyldecan-4-ol |
7567326 |
(4S,5S)-4-methyldecan-5-ol |
7567331 |
(4S,5R)-4-methyldecan-5-ol |
7567337 |
(4R,5S)-4-methyldecan-5-ol |
7567350 |
(1R)-1-cyclopentyl-2,2-dimethyl-propan-1-ol |
7567358 |
(3R,5S)-5-ethylnonan-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|