Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4040±0.0340825 |
Normalized OD Score: sc h |
1.1197±0.0252025 |
Z-Score: |
1.1813±0.126899 |
p-Value: |
0.239384 |
Z-Factor: |
-3.79315 |
Fitness Defect: |
1.4297 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.70 Celcius | Date: | 2006-01-20 YYYY-MM-DD | Plate CH Control (+): | 0.043775±0.00220 | Plate DMSO Control (-): | 0.413725±0.04833 | Plate Z-Factor: | 0.5811 |
| png ps pdf |
7227303 |
4-[(1R,2S,4R,6R)-5,5,6-trimethylnorbornan-2-yl]cyclohexan-1-ol |
7269374 |
n/a |
7271789 |
(1S,2S,3R)-2,3-dimethylcyclohexan-1-ol |
7271790 |
(1R,2S,3R)-2,3-dimethylcyclohexan-1-ol |
7271791 |
(1R,2S,3S)-2,3-dimethylcyclohexan-1-ol |
7271803 |
(1S,2R,3R,5R)-2,6,6-trimethylnorpinan-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|