Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
CKA2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8416±0.00869741 |
Normalized OD Score: sc h |
0.9987±0.00148532 |
Z-Score: |
-0.0481±0.0555464 |
p-Value: |
0.961644 |
Z-Factor: |
-10.2002 |
Fitness Defect: |
0.0391 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2006-04-03 YYYY-MM-DD | Plate CH Control (+): | 0.038175±0.00180 | Plate DMSO Control (-): | 0.826925±0.01713 | Plate Z-Factor: | 0.9275 |
| png ps pdf |
7002680 |
(5R,8S,9R,10S,13S,14R,17R)-10,13-dimethyl-17-propyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclo penta[a]phenanthren-17-ol |
7003017 |
(1S,2R,4R)-2,7,7-trimethylnorbornan-2-ol |
7003018 |
(1S,2S,4R)-2,7,7-trimethylnorbornan-2-ol |
7003191 |
(1S,2S,4S,5R)-4,5-dimethyl-2-[(1R,2S,4S)-1,7,7-trimethylnorbornan-2-yl]cyclohexan-1-ol |
7003302 |
(1R,2R,6R)-2-methyl-6-[(1S,2R,4R,6S)-5,5,6-trimethylnorbornan-2-yl]cyclohexan-1-ol |
7003969 |
(1R,5R)-bicyclo[3.2.1]octan-1-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|