Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SEC22 |
Replicates: |
2 |
Raw OD Value: r im |
0.6597±0.0190919 |
Normalized OD Score: sc h |
0.9856±0.00727844 |
Z-Score: |
-0.5050±0.276308 |
p-Value: |
0.62026 |
Z-Factor: |
-53.0067 |
Fitness Defect: |
0.4776 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2007-10-16 YYYY-MM-DD | Plate CH Control (+): | 0.039625±0.00105 | Plate DMSO Control (-): | 0.657025±0.02787 | Plate Z-Factor: | 0.8540 |
| png ps pdf |
6976771 |
[(7R,8R)-7,8-dimethyl-1-bicyclo[2.2.2]octyl]methanol |
6976772 |
[(7S,8S)-7,8-dimethyl-1-bicyclo[2.2.2]octyl]methanol |
6976773 |
[(7S,8R)-7,8-dimethyl-1-bicyclo[2.2.2]octyl]methanol |
6978740 |
(1S,2R,5S)-2,6,6-trimethylnorpinan-2-ol |
6979104 |
n/a |
6979105 |
(5R,8S,9S,10R,13S,14R,16S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta [a]phenanthren-16-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|