Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
KAR3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6493±0.00374767 |
Normalized OD Score: sc h |
0.9817±0.00919661 |
Z-Score: |
-0.8628±0.453177 |
p-Value: |
0.41212 |
Z-Factor: |
-8.424 |
Fitness Defect: |
0.8864 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.40 Celcius | Date: | 2007-09-06 YYYY-MM-DD | Plate CH Control (+): | 0.04075±0.00165 | Plate DMSO Control (-): | 0.6419250000000001±0.02653 | Plate Z-Factor: | 0.8582 |
| png ps pdf |
4558355 |
n/a |
4558431 |
n/a |
4562206 |
(3,5,7-trimethyl-1-adamantyl)oxidanium |
4601710 |
17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16- ol |
4603262 |
n/a |
4608771 |
2-tert-butylcyclooctan-1-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|