Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5444±0.00240416 |
Normalized OD Score: sc h |
1.0169±0.0031015 |
Z-Score: |
0.3045±0.0420417 |
p-Value: |
0.760844 |
Z-Factor: |
-7.08383 |
Fitness Defect: |
0.2733 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2006-03-16 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00069 | Plate DMSO Control (-): | 0.5347999999999999±0.02235 | Plate Z-Factor: | 0.8440 |
| png ps pdf |
3069681 |
2,9-dibutyl-2,9-dimethyl-decane-1,10-diol |
3069682 |
2,10-diethyl-2,10-dimethyl-undecane-1,11-diol |
3069683 |
2,11-diethyl-2,11-dimethyl-dodecane-1,12-diol |
3069684 |
2,11-dimethyl-2,11-dipropyl-dodecane-1,12-diol |
3069685 |
2,11-dibutyl-2,11-dimethyl-dodecane-1,12-diol |
3080559 |
(8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15, 16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|