Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
CNB1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8365±0.00205061 |
Normalized OD Score: sc h |
0.9968±0.000744917 |
Z-Score: |
-0.1593±0.0346089 |
p-Value: |
0.873438 |
Z-Factor: |
-7.61105 |
Fitness Defect: |
0.1353 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2006-03-03 YYYY-MM-DD | Plate CH Control (+): | 0.038425±0.00132 | Plate DMSO Control (-): | 0.8124250000000001±0.01189 | Plate Z-Factor: | 0.9663 |
| png ps pdf |
3020977 |
3,7,11,15-tetramethylhexadecan-3-ol |
3022829 |
2-(4-tert-butylcyclohexyl)propan-1-ol |
3023290 |
7,11-dimethyldodecan-3-ol |
3023291 |
3,6,10-trimethylundecan-2-ol |
3028521 |
4-propylheptan-1-ol |
3028594 |
3-propylhexan-1-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|