Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
FUR4 |
Replicates: |
2 |
Raw OD Value: r im |
0.4917±0.0262337 |
Normalized OD Score: sc h |
1.0694±0.0234508 |
Z-Score: |
1.8907±0.948279 |
p-Value: |
0.116413 |
Z-Factor: |
-2061.95 |
Fitness Defect: |
2.1506 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2006-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.0418±0.00319 | Plate DMSO Control (-): | 0.49124999999999996±0.08839 | Plate Z-Factor: | 0.5609 |
| png ps pdf |
545879 |
4,7-diethyldodecan-6-ol |
545887 |
2,4,6,8-tetramethyloctacosan-1-ol |
545928 |
2-ethyl-2-methyl-tridecan-1-ol |
545941 |
5-methyl-2-propan-2-yl-heptan-1-ol |
546032 |
2,4-ditert-butylcyclohexan-1-ol |
546041 |
3-(3,3-dimethylbutyl)cyclohexan-1-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|