| Compound Information | SONAR Target prediction | | Name: | ZEORIN | | Unique Identifier: | SPE01800055 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O2 | | Molecular Weight: | 394.336 g/mol | | X log p: | -0.0620000000000002 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | | Source: | ex various lichens, e.g., Anaptychia species | | Reference: | Bull Soc Chim 1963: 1702 | | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00530 | | Logp: | 3.73 | | Drug_category: | Sex Hormone-Binding Globulin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
HTZ1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2982±0.0263751 |
| Normalized OD Score: sc h |
1.1332±0.207286 |
| Z-Score: |
0.3326±0.603446 |
| p-Value: |
0.686352 |
| Z-Factor: |
-17.6236 |
| Fitness Defect: |
0.3764 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.60 Celcius | | Date: | 2007-09-26 YYYY-MM-DD | | Plate CH Control (+): | 0.039875±0.00080 | | Plate DMSO Control (-): | 0.25865000000000005±0.08912 | | Plate Z-Factor: | -0.9224 |
| png ps pdf |
| 542950 |
n/a |
| 542978 |
2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-ol |
| 543600 |
6,10-dimethylundecan-4-ol |
| 543604 |
9-methylbicyclo[3.3.1]nonan-9-ol |
| 543630 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a ]phenanthren-6-ol |
| 543753 |
4a-methyldecalin-1-ol |
| internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
| active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|