| Compound Information | SONAR Target prediction | | Name: | ZEORIN | | Unique Identifier: | SPE01800055 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O2 | | Molecular Weight: | 394.336 g/mol | | X log p: | -0.0620000000000002 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | | Source: | ex various lichens, e.g., Anaptychia species | | Reference: | Bull Soc Chim 1963: 1702 | | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00530 | | Logp: | 3.73 | | Drug_category: | Sex Hormone-Binding Globulin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
TOP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5914±0.0164049 |
| Normalized OD Score: sc h |
1.0157±0.0209027 |
| Z-Score: |
0.2442±0.324805 |
| p-Value: |
0.812002 |
| Z-Factor: |
-5.92662 |
| Fitness Defect: |
0.2083 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.50 Celcius | | Date: | 2006-04-26 YYYY-MM-DD | | Plate CH Control (+): | 0.040075±0.00110 | | Plate DMSO Control (-): | 0.5815±0.02355 | | Plate Z-Factor: | 0.8370 |
| png ps pdf |
| 349298 |
4,6,6-trimethylnorpinan-2-ol |
| 361345 |
n/a |
| 361791 |
(3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
| 368330 |
3,5,7-trimethyladamantan-1-ol |
| 369183 |
n/a |
| 369314 |
(3S,8R,10S,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecah ydro-1H-cyclopenta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
| active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|