Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SLT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7629±0.00311127 |
Normalized OD Score: sc h |
0.9920±0.00465451 |
Z-Score: |
-0.3956±0.229 |
p-Value: |
0.696172 |
Z-Factor: |
-3.40313 |
Fitness Defect: |
0.3622 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2006-03-21 YYYY-MM-DD | Plate CH Control (+): | 0.039099999999999996±0.00139 | Plate DMSO Control (-): | 0.75015±0.00994 | Plate Z-Factor: | 0.9531 |
| png ps pdf |
281919 |
n/a |
281928 |
n/a |
281933 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a ]phenanthren-7-ol |
281938 |
n/a |
284120 |
2-methylnorbornan-7-ol |
285424 |
pentatriacontan-18-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|