Compound Information | SONAR Target prediction | Name: | ZEORIN | Unique Identifier: | SPE01800055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O2 | Molecular Weight: | 394.336 g/mol | X log p: | -0.0620000000000002 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C | Source: | ex various lichens, e.g., Anaptychia species | Reference: | Bull Soc Chim 1963: 1702 | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BCK2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7417±0.000212132 |
Normalized OD Score: sc h |
0.9974±0.00145492 |
Z-Score: |
-0.1084±0.0477353 |
p-Value: |
0.913688 |
Z-Factor: |
-35.7795 |
Fitness Defect: |
0.0903 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2006-03-29 YYYY-MM-DD | Plate CH Control (+): | 0.039175±0.00350 | Plate DMSO Control (-): | 0.73325±0.01256 | Plate Z-Factor: | 0.9486 |
| png ps pdf |
251603 |
4-(4-methylheptan-4-yl)cyclohexan-1-ol |
253091 |
3-cyclopentyl-10,13,17-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren -17-ol |
253633 |
(2R,3S,5S,8S,9S,10S,13S,14S,17S)-2,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-c yclopenta[a]phenanthrene-3,17-diol |
253824 |
n/a |
254193 |
(3S,5R,6S,8R,9S,10S,13S,14S,17S)-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-c yclopenta[a]phenanthrene-3,17-diol |
255697 |
(3R,5R,8R,9S,10S,13S,14S,17S)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a ]phenanthrene-3,17-diol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 466 | Additional Members: 1 | Rows returned: 0 | |
|