| Compound Information | SONAR Target prediction |  | Name: | URSOLIC ACID |  | Unique Identifier: | SPE01800031  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 408.319 g/mol |  | X log p: | 1.367  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C)C(O)=O |  | Class: | triterpene |  | Source: | Rhododendron spp, Epigaea asiatica, surface wax of fruits |  | Reference: | Phytochemistry 10:3279 (1971) |  | Therapeutics: | diuretic, antineoplastic, antiulcer |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SEC22 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6723±0.0229103 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0068±0.0118148 | 
	 
	
		| Z-Score: | 
		0.2262±0.399284 | 
	 
	
		| p-Value: | 
		0.783156 | 
	 
	
		| Z-Factor: | 
		-7.85194 | 
	 
	
		| Fitness Defect: | 
		0.2444 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|F6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.50 Celcius |  | Date: | 2007-10-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.039625±0.00105 |  | Plate DMSO Control (-): | 0.657025±0.02787 |  | Plate Z-Factor: | 0.8540 |  
  |  png ps pdf |  
 
 
	
		| 10494 | 
		(4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,1 2,13,14b-tetradecahydropicene-4a-carboxylic acid | 
	 
	
		| 64945 | 
		(1S,2R,4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,1 0,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid | 
	 
	
		| 191718 | 
		(1S,2R,4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11 ,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid; (4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13 ,14b-tetradecahydropicene-4a-carboxylic acid | 
	 
	
		| 191719 | 
		(1S,2R,4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11 ,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid | 
	 
	
		| 191720 | 
		(4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13 ,14b-tetradecahydropicene-4a-carboxylic acid | 
	 
	
		| 220774 | 
		10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a -carboxylic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 8 | 1 2 Next >>  |   
 |  active | Cluster 1869 | Additional Members: 9 | Rows returned: 3 |  |   
 
 |