| 
 | Compound Information | SONAR Target prediction |  | Name: | URSOLIC ACID |  | Unique Identifier: | SPE01800031 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 408.319 g/mol |  | X log p: | 1.367  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C)C(O)=O |  | Class: | triterpene |  | Source: | Rhododendron spp, Epigaea asiatica, surface wax of fruits |  | Reference: | Phytochemistry 10:3279 (1971) |  | Therapeutics: | diuretic, antineoplastic, antiulcer | 
 
 
	
		| Species: | 4932 |  
		| Condition: | DRS2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6912±0.00205061 |  
		| Normalized OD Score: sc h | 1.0063±0.00131968 |  
		| Z-Score: | 0.2686±0.0556576 |  
		| p-Value: | 0.788418 |  
		| Z-Factor: | -441.905 |  
		| Fitness Defect: | 0.2377 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 16|F11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.50 Celcius |  | Date: | 2008-01-11 YYYY-MM-DD |  | Plate CH Control (+): | 0.042249999999999996±0.00055 |  | Plate DMSO Control (-): | 0.656775±0.01679 |  | Plate Z-Factor: | 0.9127 | 
 |  png ps
 pdf
 | 
 
 
	
		| 10494 | (4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,1 2,13,14b-tetradecahydropicene-4a-carboxylic acid
 |  
		| 64945 | (1S,2R,4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,1 0,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid
 |  
		| 191718 | (1S,2R,4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11 ,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid;
 (4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13
 ,14b-tetradecahydropicene-4a-carboxylic acid
 |  
		| 191719 | (1S,2R,4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11 ,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid
 |  
		| 191720 | (4aS,6aS,6aS,6bR,10S,12aS,14bS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13 ,14b-tetradecahydropicene-4a-carboxylic acid
 |  
		| 220774 | 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a -carboxylic acid
 |  
 | internal high similarity DBLink  | Rows returned: 8 | 1 2 Next >> | 
 
 | active | Cluster 1869 | Additional Members: 9 | Rows returned: 3 |  | 
 
 |