| Compound Information | SONAR Target prediction | | Name: | URSOLIC ACID | | Unique Identifier: | SPE01800031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 408.319 g/mol | | X log p: | 1.367 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C)C(O)=O | | Class: | triterpene | | Source: | Rhododendron spp, Epigaea asiatica, surface wax of fruits | | Reference: | Phytochemistry 10:3279 (1971) | | Therapeutics: | diuretic, antineoplastic, antiulcer |
| Species: |
4932 |
| Condition: |
MAD1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9380±0.0583363 |
| Normalized OD Score: sc h |
1.2773±0.0145436 |
| Z-Score: |
15.9026±1.65554 |
| p-Value: |
0 |
| Z-Factor: |
-0.145873 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|F6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.00 Celcius | | Date: | 2007-10-05 YYYY-MM-DD | | Plate CH Control (+): | 0.04035±0.00108 | | Plate DMSO Control (-): | 0.729675±0.06337 | | Plate Z-Factor: | 0.7189 |
|  png
ps
pdf |
| 470665 |
(4aS,6aS,6bR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-pi
cene-4a-carboxylic acid |
| 484615 |
(1S,2R,4aS,6aS,6aS,6bR,8aS,12aS,14bR)-1,2,6a,6a,6b,9,9,12a-octamethyl-10-oxo-2,3,4,5,6,7,8,8a,11,12,13,1
4b-dodecahydro-1H-picene-4a-carboxylic acid |
| 485185 |
(1S,2R,4aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11
,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| 485707 |
(4aS,6aS,6bR,10R,12aS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetr
adecahydropicene-4a-carboxylic acid |
| 485708 |
(1S,4aR,4bS,6aS)-1-(2-carboxyethyl)-1,4a,4b,9,9-pentamethyl-2-propan-2-yl-3,4,5,6,7,8,10,10a,12,12a-deca
hydro-2H-chrysene-6a-carboxylic acid |
| 510095 |
(1S,2R,4aS,6bR,10R,12aS)-10-hydroxy-1,2,6b,9,9,12a-hexamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-h
exadecahydropicene-4a-carboxylic acid |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 1869 | Additional Members: 9 | Rows returned: 3 | |
|
