| Compound Information | SONAR Target prediction |
| Name: | TETRAHYDROCORTISONE-21-ACETATE |
| Unique Identifier: | SPE01701048 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C23H34O6 |
| Molecular Weight: | 373.25 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4CC(O)CCC4(C)C3C(=O)CC21C |
| Class: | sterol |
| Source: | derivative microbial degradation of cortisone |
| Reference: | Z Naturforsch B 18: 284 (1963) |
| Found: 91 nonactive as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [91] |
| Species: | 4932 |
| Condition: | HHF1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6894±0.0345775 |
| Normalized OD Score: sc h | 1.0272±0.0108286 |
| Z-Score: | 1.1782±0.423121 |
| p-Value: | 0.259486 |
| Z-Factor: | -7.71505 |
| Fitness Defect: | 1.3491 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 7027 | Additional Members: 5 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory