Compound Information | SONAR Target prediction | Name: | TETRAHYDROCORTISONE | Unique Identifier: | SPE01701047 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H32O5 | Molecular Weight: | 333.23 g/mol | X log p: | -2.158 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(O)(C(=O)CO)C3(C)CC(=O)C12 | Source: | exmicrobial degradation of cortisone | Reference: | J Biol Chem 111: 599 (1935); 114: 613 (1936);124: 459 (1938); Z Naturforsch B 18: 284 (1963) |
Species: |
4932 |
Condition: |
MDH1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7817±0.0704278 |
Normalized OD Score: sc h |
1.0026±0.0314098 |
Z-Score: |
0.0480±1.78615 |
p-Value: |
0.207114 |
Z-Factor: |
-17.5467 |
Fitness Defect: |
1.5745 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|G10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2007-08-07 YYYY-MM-DD | Plate CH Control (+): | 0.039675±0.00047 | Plate DMSO Control (-): | 0.762275±0.10782 | Plate Z-Factor: | 0.5394 |
| png ps pdf |
5866 |
(3R,5R,8S,9S,10S,13S,14S,17R)-3,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,1 5,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
65554 |
(5R,8S,9S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,12,14,15,16-do decahydrocyclopenta[a]phenanthrene-3,11-dione |
101762 |
(3R,5S,8S,9S,10S,13S,14S,17R)-3,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,1 5,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
440054 |
(5S,8S,9S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,12,14,15,16-do decahydrocyclopenta[a]phenanthrene-3,11-dione |
440692 |
(3R,17R)-3,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-c yclopenta[a]phenanthren-11-one |
618110 |
3,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta [a]phenanthren-11-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 7027 | Additional Members: 5 | Rows returned: 0 | |
|