Compound Information | SONAR Target prediction | Name: | TETRAHYDROCORTISONE | Unique Identifier: | SPE01701047 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H32O5 | Molecular Weight: | 333.23 g/mol | X log p: | -2.158 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(O)(C(=O)CO)C3(C)CC(=O)C12 | Source: | exmicrobial degradation of cortisone | Reference: | J Biol Chem 111: 599 (1935); 114: 613 (1936);124: 459 (1938); Z Naturforsch B 18: 284 (1963) |
Species: |
4932 |
Condition: |
CIN8 |
Replicates: |
2 |
Raw OD Value: r im |
0.7808±0.0019799 |
Normalized OD Score: sc h |
0.9955±0.00236716 |
Z-Score: |
-0.2466±0.13258 |
p-Value: |
0.806018 |
Z-Factor: |
-57.4793 |
Fitness Defect: |
0.2156 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|G10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2006-02-24 YYYY-MM-DD | Plate CH Control (+): | 0.0383±0.00129 | Plate DMSO Control (-): | 0.770825±0.01013 | Plate Z-Factor: | 0.9541 |
| png ps pdf |
621102 |
17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phena nthrene-3,11-dione |
6429565 |
(3R,5S,17R)-3,17-dihydroxy-17-(2-hydroxyacetyl)-2,3,4,5,6,7,8,9,10,12,13,14,15,16-tetradecahydro-1H-cycl openta[a]phenanthren-11-one |
6429566 |
(3R,5R,17R)-3,17-dihydroxy-17-(2-hydroxyacetyl)-2,3,4,5,6,7,8,9,10,12,13,14,15,16-tetradecahydro-1H-cycl openta[a]phenanthren-11-one |
6710632 |
(3R,5R,10S,13S,17R)-3,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodec ahydro-1H-cyclopenta[a]phenanthren-11-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 7027 | Additional Members: 5 | Rows returned: 0 | |
|