| Compound Information | SONAR Target prediction |  | Name: | CORTISONE |  | Unique Identifier: | SPE01701028  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 332.222 g/mol |  | X log p: | -0.578  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 51.21 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC12CCC(=O)C=C1CCC1C3CCC(O)(C(=O)CO)C3(C)CC(=O)C12 |  | Class: | sterol |  | Source: | adrenal cortical hormone |  | Reference: | Helv Chim Acta 19:1107 (1936); 20:978 (1937);  JACS 70:1454 (1948) |  | Therapeutics: | antiinflammatory, glucocorticoid |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MDH1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7734±0.0451841 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9938±0.00088832 | 
	 
	
		| Z-Score: | 
		-0.3567±0.0917103 | 
	 
	
		| p-Value: | 
		0.721856 | 
	 
	
		| Z-Factor: | 
		-21.293 | 
	 
	
		| Fitness Defect: | 
		0.3259 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|B11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.50 Celcius |  | Date: | 2007-08-07 YYYY-MM-DD |  | Plate CH Control (+): | 0.039675±0.00047 |  | Plate DMSO Control (-): | 0.762275±0.10782 |  | Plate Z-Factor: | 0.5394 |  
  |  png ps pdf |  
 
 
	
		| 5316089 | 
		(10R,13S,17S)-17-hydroxy-17-(2-hydroxyacetyl)-10,13,14-trimethyl-2,6,7,8,9,12,15,16-octahydro-1H-cyclope nta[a]phenanthrene-3,11-dione | 
	 
	
		| 5460098 | 
		(8S,9S,10R,13S,14S)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocycl openta[a]phenanthrene-3,11-dione | 
	 
	
		| 6546961 | 
		(8S,9R,10R,13R,14S,17S)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione | 
	 
	
		| 6603771 | 
		(8S,9S,10S,13R,14R,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione | 
	 
	
		| 6708812 | 
		(10R,13S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta [a]phenanthrene-3,11-dione | 
	 
	
		| 6957675 | 
		(8R,9S,10S,13S,14R,17S)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydro cyclopenta[a]phenanthrene-3,11-dione | 
	 
 
 | internal high similarity DBLink  | Rows returned: 2 |  |   
 |  active | Cluster 11390 | Additional Members: 8 | Rows returned: 0 |  |  
  
 |