| Compound Information | SONAR Target prediction | | Name: | 7,3--DIMETHOXYFLAVONE | | Unique Identifier: | SPE01600652 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cccc(c1)C1Oc2cc(OC)ccc2C(=O)C=1 | | Source: | analog |
| Species: |
4932 |
| Condition: |
SPE00200054 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5746±0.0188798 |
| Normalized OD Score: sc h |
0.9116±0.0226045 |
| Z-Score: |
-4.0784±0.977205 |
| p-Value: |
0.000353758 |
| Z-Factor: |
-0.917039 |
| Fitness Defect: |
7.9469 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.00 Celcius | | Date: | 2006-12-15 YYYY-MM-DD | | Plate CH Control (+): | 0.042249999999999996±0.00229 | | Plate DMSO Control (-): | 0.6222±0.03074 | | Plate Z-Factor: | 0.8668 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 688672 |
7-methoxy-2-(3-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| nonactive | Cluster 11689 | Additional Members: 8 | Rows returned: 3 | |
|