Compound Information | SONAR Target prediction | Name: | 7,3--DIMETHOXYFLAVONE | Unique Identifier: | SPE01600652 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cccc(c1)C1Oc2cc(OC)ccc2C(=O)C=1 | Source: | analog |
Species: |
4932 |
Condition: |
SPE01502247 |
Replicates: |
2 |
Raw OD Value: r im |
0.4589±0.0260922 |
Normalized OD Score: sc h |
0.7934±0.0247493 |
Z-Score: |
-5.3205±1.62757 |
p-Value: |
0.0000152563 |
Z-Factor: |
-1.0462 |
Fitness Defect: |
11.0905 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.10 Celcius | Date: | 2006-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.0403±0.00268 | Plate DMSO Control (-): | 0.67215±0.15383 | Plate Z-Factor: | 0.4142 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688672 |
7-methoxy-2-(3-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
nonactive | Cluster 11689 | Additional Members: 8 | Rows returned: 3 | |
|