Compound Information | SONAR Target prediction | Name: | 7,3--DIMETHOXYFLAVONE | Unique Identifier: | SPE01600652 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cccc(c1)C1Oc2cc(OC)ccc2C(=O)C=1 | Source: | analog |
Species: |
4932 |
Condition: |
CNB1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7346±0.0214253 |
Normalized OD Score: sc h |
1.0359±0.0318291 |
Z-Score: |
1.3512±1.20975 |
p-Value: |
0.323702 |
Z-Factor: |
-2.9852 |
Fitness Defect: |
1.1279 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 23|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2006-04-12 YYYY-MM-DD | Plate CH Control (+): | 0.038675±0.00174 | Plate DMSO Control (-): | 0.6825249999999999±0.01124 | Plate Z-Factor: | 0.9375 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688672 |
7-methoxy-2-(3-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 11689 | Additional Members: 8 | Rows returned: 2 | |
|