Compound Information | SONAR Target prediction | Name: | 7,3--DIMETHOXYFLAVONE | Unique Identifier: | SPE01600652 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cccc(c1)C1Oc2cc(OC)ccc2C(=O)C=1 | Source: | analog |
Species: |
4932 |
Condition: |
SPE01500381 |
Replicates: |
2 |
Raw OD Value: r im |
0.7688±0.0482247 |
Normalized OD Score: sc h |
0.9330±0.0717199 |
Z-Score: |
-2.6425±2.84854 |
p-Value: |
0.26491 |
Z-Factor: |
-2.89155 |
Fitness Defect: |
1.3284 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.20 Celcius | Date: | 2006-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.039175±0.00250 | Plate DMSO Control (-): | 0.8861749999999999±0.13789 | Plate Z-Factor: | 0.5954 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688672 |
7-methoxy-2-(3-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 11689 | Additional Members: 8 | Rows returned: 2 | |
|