| Compound Information | SONAR Target prediction |  | Name: | 7,3--DIMETHOXYFLAVONE |  | Unique Identifier: | SPE01600652  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 268.18 g/mol |  | X log p: | 17.421  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1cccc(c1)C1Oc2cc(OC)ccc2C(=O)C=1 |  | Source: | analog |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE01500403 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5835±0.0181019 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9179±0.00704722 | 
	 
	
		| Z-Score: | 
		-4.2275±0.541696 | 
	 
	
		| p-Value: | 
		0.000062423 | 
	 
	
		| Z-Factor: | 
		-1.07057 | 
	 
	
		| Fitness Defect: | 
		9.6816 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|H3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.80 Celcius |  | Date: | 2007-01-04 YYYY-MM-DD |  | Plate CH Control (+): | 0.042275±0.00245 |  | Plate DMSO Control (-): | 0.618375±0.03644 |  | Plate Z-Factor: | 0.8351 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 688672 | 
		7-methoxy-2-(3-methoxyphenyl)chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 11 | 1 2 Next >>  |   
 |  active | Cluster 11689 | Additional Members: 8 | Rows returned: 2 |  |   
 
 |