| Compound Information | SONAR Target prediction | | Name: | 7,3--DIMETHOXYFLAVONE | | Unique Identifier: | SPE01600652 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cccc(c1)C1Oc2cc(OC)ccc2C(=O)C=1 | | Source: | analog |
| Species: |
4932 |
| Condition: |
BEM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3346±0.0247487 |
| Normalized OD Score: sc h |
0.6993±0.0529913 |
| Z-Score: |
-8.8325±1.41799 |
| p-Value: |
0.0000000000000024425 |
| Z-Factor: |
0.104618 |
| Fitness Defect: |
33.6458 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 24|E2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.70 Celcius | | Date: | 2008-02-05 YYYY-MM-DD | | Plate CH Control (+): | 0.0417±0.00216 | | Plate DMSO Control (-): | 0.46287500000000004±0.01623 | | Plate Z-Factor: | 0.8860 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 688672 |
7-methoxy-2-(3-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 11689 | Additional Members: 8 | Rows returned: 2 | |
|
