Compound Information | SONAR Target prediction | Name: | PSEUDOBAPTIGENIN | Unique Identifier: | SPE01600568 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 272.168 g/mol | X log p: | 15.443 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc2C(=O)C(=COc2c1)c1ccc2OCOc2c1 | Source: | Baptisia, Cladrastis, Dalbergia & Trifolium spp; also Maackia, Pisum, Pterocarpus spp | Reference: | J Chem Soc 1953: 1582 |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.6923±0.000353553 |
Normalized OD Score: sc h |
0.9975±0.00468729 |
Z-Score: |
-0.1082±0.181639 |
p-Value: |
0.898396 |
Z-Factor: |
-44.8241 |
Fitness Defect: |
0.1071 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.90 Celcius | Date: | 2008-02-08 YYYY-MM-DD | Plate CH Control (+): | 0.04005±0.00043 | Plate DMSO Control (-): | 0.6682999999999999±0.01979 | Plate Z-Factor: | 0.9001 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5281805 |
3-benzo[1,3]dioxol-5-yl-7-hydroxy-chromen-4-one |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 8155 | Additional Members: 16 | Rows returned: 3 | |
|