| Compound Information | SONAR Target prediction | | Name: | QUERCETIN PENTAMETHYL ETHER | | Unique Identifier: | SPE01600075 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.21 g/mol | | X log p: | 12.426 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 72.45 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | COc1cc(OC)c2C(=O)C(OC)=C(Oc2c1)c1ccc(OC)c(OC)c1 | | Class: | flavone | | Source: | derivative |
| Species: |
4932 |
| Condition: |
CIN8 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7843±0.00721249 |
| Normalized OD Score: sc h |
1.0107±0.00441658 |
| Z-Score: |
0.0127±0.240992 |
| p-Value: |
0.8647 |
| Z-Factor: |
-12.4671 |
| Fitness Defect: |
0.1454 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 7|C11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2006-02-24 YYYY-MM-DD | | Plate CH Control (+): | 0.0383±0.00129 | | Plate DMSO Control (-): | 0.770825±0.01013 | | Plate Z-Factor: | 0.9541 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 97332 |
2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxy-chromen-4-one |
| 634113 |
3,5,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 2 | |
| nonactive | Cluster 7222 | Additional Members: 3 | Rows returned: 2 | |
|