Compound Information | SONAR Target prediction | Name: | QUERCETIN PENTAMETHYL ETHER | Unique Identifier: | SPE01600075 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.21 g/mol | X log p: | 12.426 (online calculus) | Lipinksi Failures | 1 | TPSA | 72.45 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 6 | Canonical Smiles: | COc1cc(OC)c2C(=O)C(OC)=C(Oc2c1)c1ccc(OC)c(OC)c1 | Class: | flavone | Source: | derivative |
Species: |
4932 |
Condition: |
SPT3 |
Replicates: |
2 |
Raw OD Value: r im |
0.4229±0.0555079 |
Normalized OD Score: sc h |
0.9099±0.0224344 |
Z-Score: |
-1.0442±0.276255 |
p-Value: |
0.305542 |
Z-Factor: |
-1.78333 |
Fitness Defect: |
1.1857 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|D10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.40 Celcius | Date: | 2008-02-13 YYYY-MM-DD | Plate CH Control (+): | 0.040625±0.00054 | Plate DMSO Control (-): | 0.43672500000000003±0.02170 | Plate Z-Factor: | 0.8180 |
| png ps pdf |
DBLink | Rows returned: 2 | |
97332 |
2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxy-chromen-4-one |
634113 |
3,5,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 7222 | Additional Members: 3 | Rows returned: 1 | |
|