| Compound Information | SONAR Target prediction |
| Name: | DESONIDE |
| Unique Identifier: | SPE01505726 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C24H32O6 |
| Molecular Weight: | 384.253 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC1(C)OC2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)C2(O1)C(=O)CO |
| Source: | semisynthetic; D-2083 |
| Therapeutics: | antiinflammatory, glucocorticoid |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [104] |
| Species: | 4932 |
| Condition: | TOR1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.9584±0.00735391 |
| Normalized OD Score: sc h | 0.9496±0.0224247 |
| Z-Score: | -0.2235±0.740343 |
| p-Value: | 0.60962 |
| Z-Factor: | -1.32115 |
| Fitness Defect: | 0.4949 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 17014 | Additional Members: 17 | Rows returned: 2 |
| Prest1079 | 0.577319587628866 |
| Prest840 | 0.425287356321839 |
Service provided by the
Mike Tyers Laboratory