| Compound Information | SONAR Target prediction |  | Name: | DESOXYMETASONE |  | Unique Identifier: | SPE01505722  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C22FH29O4 |  | Molecular Weight: | 347.231 g/mol |  | X log p: |   (online calculus) |  | Lipinksi Failures |  |  | TPSA |  |  | Hydrogen Bond Donor Count: |  |  | Hydrogen Bond Acceptors Count: |  |  | Rotatable Bond Count: |  |  | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)CO |  | Source: | semisynthetic; HOE-304, R-2113, A-41-304 |  | Therapeutics: | antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPT3 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4592±0.0109602 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9758±0.0516428 | 
	 
	
		| Z-Score: | 
		0.0697±0.964919 | 
	 
	
		| p-Value: | 
		0.496096 | 
	 
	
		| Z-Factor: | 
		-12.8438 | 
	 
	
		| Fitness Defect: | 
		0.701 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 21|E3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.20 Celcius |  | Date: | 2008-02-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.04214999999999999±0.00098 |  | Plate DMSO Control (-): | 0.43772500000000003±0.01741 |  | Plate Z-Factor: | 0.8594 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 0 |  |  
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 |  |   
 
 |