Compound Information | SONAR Target prediction | Name: | DESOXYMETASONE | Unique Identifier: | SPE01505722 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22FH29O4 | Molecular Weight: | 347.231 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)CO | Source: | semisynthetic; HOE-304, R-2113, A-41-304 | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
RPA49 |
Replicates: |
2 |
Raw OD Value: r im |
0.6254±0.00240416 |
Normalized OD Score: sc h |
0.9989±0.00781475 |
Z-Score: |
-0.0464±0.274976 |
p-Value: |
0.845998 |
Z-Factor: |
-45.9537 |
Fitness Defect: |
0.1672 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2007-12-13 YYYY-MM-DD | Plate CH Control (+): | 0.0414±0.00080 | Plate DMSO Control (-): | 0.5917749999999999±0.02008 | Plate Z-Factor: | 0.8778 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|