| Compound Information | SONAR Target prediction | | Name: | DESOXYMETASONE | | Unique Identifier: | SPE01505722 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C22FH29O4 | | Molecular Weight: | 347.231 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)CO | | Source: | semisynthetic; HOE-304, R-2113, A-41-304 | | Therapeutics: | antiinflammatory |
| Species: |
4932 |
| Condition: |
PAF1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6888±0.00360624 |
| Normalized OD Score: sc h |
0.9969±0.00342364 |
| Z-Score: |
-0.1863±0.205272 |
| p-Value: |
0.853714 |
| Z-Factor: |
-27.3182 |
| Fitness Defect: |
0.1582 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|E3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.60 Celcius | | Date: | 2008-07-09 YYYY-MM-DD | | Plate CH Control (+): | 0.04145±0.00046 | | Plate DMSO Control (-): | 0.6864250000000001±0.01597 | | Plate Z-Factor: | 0.9296 |
| png ps pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|