Compound Information | SONAR Target prediction | Name: | DESOXYMETASONE | Unique Identifier: | SPE01505722 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22FH29O4 | Molecular Weight: | 347.231 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)CO | Source: | semisynthetic; HOE-304, R-2113, A-41-304 | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
GSY2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6908±0.0106066 |
Normalized OD Score: sc h |
1.0036±0.00509589 |
Z-Score: |
0.1662±0.238606 |
p-Value: |
0.867838 |
Z-Factor: |
-71.5022 |
Fitness Defect: |
0.1418 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.70 Celcius | Date: | 2008-04-30 YYYY-MM-DD | Plate CH Control (+): | 0.040575±0.00052 | Plate DMSO Control (-): | 0.6759249999999999±0.01942 | Plate Z-Factor: | 0.9146 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|