Compound Information | SONAR Target prediction | Name: | DESOXYMETASONE | Unique Identifier: | SPE01505722 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22FH29O4 | Molecular Weight: | 347.231 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)CO | Source: | semisynthetic; HOE-304, R-2113, A-41-304 | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
pdr_yCG196 |
Replicates: |
2 |
Raw OD Value: r im |
0.7310±0.0155563 |
Normalized OD Score: sc h |
0.9993±0.000452362 |
Z-Score: |
-0.0245±0.0149433 |
p-Value: |
0.980494 |
Z-Factor: |
-670.5 |
Fitness Defect: |
0.0197 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 10|H8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09325±0.00804 | Plate DMSO Control (-): | 0.9219999999999999±0.01780 | Plate Z-Factor: | 0.8791 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|