| Compound Information | SONAR Target prediction |
| Name: | EPIRUBICIN HYDROCHLORIDE |
| Unique Identifier: | SPE01505708 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C27ClH30NO11 |
| Molecular Weight: | 549.742 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Cl.COc1cccc2c(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(O)C(C)O5)c4c(O)c3c(=O)c12) C(=O)CO |
| Source: | synthetic; IMI-28 |
| Therapeutics: | antineoplastic |
| Found: 41 nonactive | as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [41] |
| Species: | 4932 |
| Condition: | BCK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6680±0.0183848 |
| Normalized OD Score: sc h | 0.9581±0.00392539 |
| Z-Score: | -1.4414±0.264599 |
| p-Value: | 0.156567 |
| Z-Factor: | -1.92251 |
| Fitness Defect: | 1.8543 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 5481 | Additional Members: 8 | Rows returned: 5 |
| LOPAC 00975 | 0.36734693877551 |
| SPE01500223 | 0.172043010752688 |
| Prest791 | 0.172043010752688 |
| SPE01505483 | 0 |
| Prest188 | 0 |
Service provided by the
Mike Tyers Laboratory