| Compound Information | SONAR Target prediction |
| Name: | TOREMIPHENE CITRATE |
| Unique Identifier: | SPE01505682 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C32ClH36NO8 |
| Molecular Weight: | 561.797 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CN(C)CCOc1ccc(cc1)C(=C(CCCl)c1ccccc1)c1ccccc1.OC(=O)CC(O)(CC(O)=O)C(O) =O |
| Source: | synthetic; FC-1157a |
| Therapeutics: | antineoplastic, anti-estrogen |
| Found: 100 active | as graph: single | with analogs | [1] << Back 21 22 23 24 25 26 27 28 29 30 Next >> [100] |
| Species: | 4932 |
| Condition: | DOA4 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.0426±0.000707107 |
| Normalized OD Score: sc h | 0.0653±0.0000350095 |
| Z-Score: | -37.1006±0.965559 |
| p-Value: | 0 |
| Z-Factor: | 0.931991 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Toxic |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 3471 | Additional Members: 6 | Rows returned: 3 |
| SPE01500196 | 0.474576271186441 |
| LOPAC 00466 | 0 |
| SPE01500557 | 0 |
Service provided by the
Mike Tyers Laboratory