| Compound Information | SONAR Target prediction |
| Name: | CEFPODOXIME PROXETIL |
| Unique Identifier: | SPE01505637 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C21H27N5O9S2 |
| Molecular Weight: | 530.385 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | COCC1CSC2C(NC(=O)C(=NOC)c3csc(N)n3)C(=O)N2C=1C(=O)OC(C)OC(=O)OC(C)C |
| Source: | semisynthetic; U-76252, CS-807 |
| Therapeutics: | antibacterial |
| Found: 104 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [104] |
| Species: | 4932 |
| Condition: | BCK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6820±0.0086267 |
| Normalized OD Score: sc h | 0.9829±0.00101666 |
| Z-Score: | -0.5738±0.0655505 |
| p-Value: | 0.566504 |
| Z-Factor: | -7.1015 |
| Fitness Defect: | 0.5683 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 437 | Additional Members: 14 | Rows returned: 2 |
| SPE01503111 | 0.340425531914894 |
| SPE01502033 | 0.289156626506024 |
Service provided by the
Mike Tyers Laboratory