| Compound Information | SONAR Target prediction |
| Name: | |
| Unique Identifier: | SPE01505433 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 418.322 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Cc1cnc(cn1)C(=O)NCCc1ccc(cc1)S(=O)(=O)NC(=O)NC1CCCCC1 |
| Found: 13 nonactive as graph: single | with analogs | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | BY4741-2nd |
| Replicates: | 2 |
| Raw OD Value: r im | 0.9220±0 |
| Normalized OD Score: sc h | 0.9635±0 |
| Z-Score: | -0.3454±0 |
| p-Value: | 0.729808 |
| Z-Factor: | -3.07801 |
| Fitness Defect: | 0.315 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory