| Compound Information | SONAR Target prediction |
| Name: | |
| Unique Identifier: | SPE01505433 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 418.322 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Cc1cnc(cn1)C(=O)NCCc1ccc(cc1)S(=O)(=O)NC(=O)NC1CCCCC1 |
| Found: 13 nonactive as graph: single | with analogs | << Back 11 12 13 |
| Species: | 4932 |
| Condition: | TOR1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.9296±0.00806102 |
| Normalized OD Score: sc h | 0.9238±0.00689291 |
| Z-Score: | -0.9936±0.125411 |
| p-Value: | 0.322328 |
| Z-Factor: | -0.606415 |
| Fitness Defect: | 1.1322 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory