| Compound Information | SONAR Target prediction |
| Name: | FLUORESCEIN |
| Unique Identifier: | SPE01505396 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C20H12O5 |
| Molecular Weight: | 320.211 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Oc1ccc2c(Oc3cc(O)ccc3C32OC(=O)c2ccccc23)c1 |
| Source: | synthetic |
| Therapeutics: | corneal trama indicator |
| Found: 104 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [104] |
| Species: | 4932 |
| Condition: | AAT2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7323±0.010748 |
| Normalized OD Score: sc h | 1.0109±0.0000913586 |
| Z-Score: | 0.5790±0.0173151 |
| p-Value: | 0.56263 |
| Z-Factor: | -2.61858 |
| Fitness Defect: | 0.5751 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 5860 | Additional Members: 5 | Rows returned: 1 |
| SPE01500480 | 0 |
Service provided by the
Mike Tyers Laboratory