| Compound Information | SONAR Target prediction |
| Name: | NISOLDIPINE |
| Unique Identifier: | SPE01505390 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C20H24N2O6 |
| Molecular Weight: | 364.224 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | [O-][N+](=O)c1ccccc1C1C(=C(C)NC(C)=C1C(=O)OCC(C)C)C(=O)OC |
| Source: | synthetic; bayk-5552 |
| Therapeutics: | vasodilator (coronary) |
| Found: 11 nonactive | as graph: single | with analogs | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | RRP6 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5656±0.00692965 |
| Normalized OD Score: sc h | 0.9524±0.0147082 |
| Z-Score: | -1.7388±0.463175 |
| p-Value: | 0.0984814 |
| Z-Factor: | -2.29994 |
| Fitness Defect: | 2.3179 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 5071 | Additional Members: 12 | Rows returned: 3 |
| SPE01500431 | 0 |
| LOPAC 00213 | 0 |
| Prest357 | 0 |
Service provided by the
Mike Tyers Laboratory