| Compound Information | SONAR Target prediction |
| Name: | HEXAMETHYLQUERCETAGETIN |
| Unique Identifier: | SPE01505383 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C21H22O8 |
| Molecular Weight: | 380.22 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | COc1ccc(cc1OC)C1Oc2cc(OC)c(OC)c(OC)c2C(=O)C=1OC |
| Class: | flavone |
| Source: | Citrus spp |
| Reference: | Phytochemistry 11:2283 (1972) |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 101 102 103 104 Next >> [104] |
| Species: | 4932 |
| Condition: | NPR1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.9842±0.010748 |
| Normalized OD Score: sc h | 0.9563±0.00609102 |
| Z-Score: | -0.0052±0.452647 |
| p-Value: | 0.748918 |
| Z-Factor: | -1.50638 |
| Fitness Defect: | 0.2891 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 7222 | Additional Members: 3 | Rows returned: 1 |
| SPE01505380 | 0.259259259259259 |
Service provided by the
Mike Tyers Laboratory