| Compound Information | SONAR Target prediction |
| Name: | ACEDAPSONE |
| Unique Identifier: | SPE01505376 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C16H16N2O4S |
| Molecular Weight: | 316.248 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(=O)Nc1ccc(cc1)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| Source: | synthetic; CI-556, CN-1883, DADDS, PAM-MAR-1165 |
| Therapeutics: | antimalarial, leprostatic |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 91 92 93 94 95 96 97 98 99 100 Next >> [104] |
| Species: | 4932 |
| Condition: | HOG1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5855±0.0205061 |
| Normalized OD Score: sc h | 0.9724±0.0159412 |
| Z-Score: | -0.7236±0.312945 |
| p-Value: | 0.480058 |
| Z-Factor: | -5.11428 |
| Fitness Defect: | 0.7338 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 11648 | Additional Members: 26 | Rows returned: 1 |
| SPE01500101 | 0.333333333333333 |
Service provided by the
Mike Tyers Laboratory