Compound Information | SONAR Target prediction | Name: | ZOLPIDEM | Unique Identifier: | SPE01505369 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C19H21N3O | Molecular Weight: | 286.223 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | CN(C)C(=O)Cc1n2C=C(C)C=Cc2nc1c1ccc(C)cc1 | Source: | synthetic; SL-80.0750-23N | Therapeutics: | sedative, hypnotic |
Species: |
4932 |
Condition: |
MSN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6651±0.0105359 |
Normalized OD Score: sc h |
0.9912±0.0106212 |
Z-Score: |
-0.4209±0.494987 |
p-Value: |
0.692104 |
Z-Factor: |
-7.40176 |
Fitness Defect: |
0.368 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 8|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2008-02-29 YYYY-MM-DD | Plate CH Control (+): | 0.0409±0.00238 | Plate DMSO Control (-): | 0.6528499999999999±0.01683 | Plate Z-Factor: | 0.9123 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 14433 | Additional Members: 1 | Rows returned: 0 | |
|