Compound Information | SONAR Target prediction | Name: | ZOLPIDEM | Unique Identifier: | SPE01505369 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C19H21N3O | Molecular Weight: | 286.223 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | CN(C)C(=O)Cc1n2C=C(C)C=Cc2nc1c1ccc(C)cc1 | Source: | synthetic; SL-80.0750-23N | Therapeutics: | sedative, hypnotic |
Species: |
4932 |
Condition: |
MED2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5670±0.00452548 |
Normalized OD Score: sc h |
1.0146±0.00718281 |
Z-Score: |
0.6295±0.303182 |
p-Value: |
0.538374 |
Z-Factor: |
-6.47154 |
Fitness Defect: |
0.6192 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 8|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.00 Celcius | Date: | 2008-04-29 YYYY-MM-DD | Plate CH Control (+): | 0.04095±0.00049 | Plate DMSO Control (-): | 0.542525±0.02011 | Plate Z-Factor: | 0.8791 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 14433 | Additional Members: 1 | Rows returned: 0 | |
|